LNP Lipid-4 | MedChemExpress (MCE)
LNP Lipid-4 (Compound 8-8) is a lipid compound. LNP Lipid-4 is involved in the synthesis of lipid nanoparticles compositions. LNP Lipid-4 has potential applications in the transportation of biologically active substances[1].
| Trivial name | LNP Lipid-4 |
| Catalog Number | HY-153187 |
| Research Area | Others |
| CAS# | 2795397-84-9 |
| Purity | ≥98.00% |
| SMILES | O=C(CCC(OCCCCCCCC)OCCCCCCCC)OCCCCCN(CCCCCOC(CCC(OCCCCCCCC)OCCCCCCCC)=O)CCO |
| PubChem Chemical Structure ID | 164552497 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lnp-lipid-4.html |