Nicergoline
Nicergoline is a non-selective alpha-adrenergic receptor antagonist which can decrease vascular resistance and increase arterial blood flow in the brain, improving the utilization of oxygen and glucose by brain cells.
| Trivial name | / |
| Catalog Number | CSN16735 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C24H26BrN3O3 |
| CAS# | 27848-84-6 |
| Purity | ≥98% |
| SMILES | O=C(OC[C@H](C[C@]12OC)CN(C)[C@]2([H])CC3=CN(C)C4=C3C1=CC=C4)C5=CN=CC(Br)=C5 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/nicergoline.html |