Uridine-5′-diphosphate disodium salt
UDP is a specific agonist of the P2Y6 receptors (EC50 = 13 nM for human P2Y6), stimulating the production of inflammatory mediators, phagocytosis, and vasoconstriction. UDP also acts as an antagonist of P2Y14.
| Catalog Number | T4706 |
| Alternative Name(s) | UDP disodium salt , Uridine 5'-diphosphate disodium salt hyd |
| Research Area | GPCR/G Protein|||Metabolism|||DNA Damage/DNA Repair|||Cell Cycle/Checkpoint|||Neuroscience |
| Molecular Formula | C9H14N2Na2O12P2 |
| CAS# | 27821-45-0 |
| SMILES | O[C@H]1[C@H](N2C(NC(C=C2)=O)=O)O[C@@H]([C@H]1O)COP(OP(O)(O)=O)(O)=O.[Na].[Na] |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Uridine-5'-diphosphate disodium salt |
| Additional Information | https://www.targetmol.com/datasheet/T4706 |