MC-GGFG-NH-CH2-O-CH2-cyclopropane-COOH | MedChemExpress (MCE)
MC-GGFG-NH-CH2-O-CH2-cyclopropane-COOH is an ADC linker that can be combined with the cytotoxic Camptothecin (HY-16560) to form ADC-related drug-linker conjugates (Drug-Linker Conjugates for ADC ).MC-GGFG-NH-CH2-O-CH2-cyclopropane-COOH is conjugated to Camptothecin, which can further bind to the antibody Trastuzumab (HY-P9907) to form Antibody-Drug Conjugates (ADCs)[1].
| Trivial name | MC-GGFG-NH-CH2-O-CH2-cyclopropane-COOH |
| Catalog Number | HY-49929 |
| Research Area | Cancer |
| CAS# | 2778374-70-0 |
| Purity | ≥98.00% |
| SMILES | O=C(C=CC1=O)N1CCCCCC(NCC(NCC(N[C@@H](CC2=CC=CC=C2)C(NCC(NCOC(C3CC3)C(O)=O)=O)=O)=O)=O)=O |
| PubChem Chemical Structure ID | 169450593 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-ggfg-nh-ch2-o-ch2-cyclopropane-cooh.html |