Zevotrelvir | MedChemExpress (MCE)
Zevotrelvir (Compound 52) is a coronavirus inhibitor with IC50 ranges of <0.1 μM and <0.1mM for 229E hCoV and SARS-CoV-23C-like (3CL) proteases, respectively. Zevotrelvir has the potential to study viral infections[1].
| Trivial name | Zevotrelvir |
| Catalog Number | HY-156651 |
| Research Area | Infection |
| CAS# | 2773516-53-1 |
| Purity | ≥98.00% |
| SMILES | O=C1[C@@]2(CN([C@@H](C2)C#N)C([C@H](CC(C)C)N(C)C(C3=CC4=C(F)C=C(F)C(F)=C4N3)=O)=O)C5=CC=CC=C5N1 |
| PubChem Chemical Structure ID | 163373364 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zevotrelvir.html |