Tubulin inhibitor 41 | MedChemExpress (MCE)
Tubulin inhibitor 41 (Compd D19), a promising anti-GBM (glioblastoma) lead compound and tublin inhibitor with BBB permeability, induces G2/M phase arrest, resulted in cell apoptosis and inhibits the migration of U87 cells[1].
| Trivial name | Tubulin inhibitor 41 |
| Catalog Number | HY-161256 |
| Research Area | Cancer |
| CAS# | 2770273-12-4 |
| Purity | ≥98.0% |
| SMILES | N#CC(C1C2=CC=CC=C2)=C(N)OC3=C1C=CC4=C3N=C(C)C=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tubulin-inhibitor-41.html |