LRRK2-IN-8 | MedChemExpress (MCE)
LRRK2-IN-8 is a LRRK2 inhibitor. LRRK2-IN-8 inhibits LRRK2 (wt) and LRRK2 (G2019) with IC50s lower than 10 nM, and inhibits TYK2 and NUAK1 with IC50s of 10-100 nM[1].
| Trivial name | LRRK2-IN-8 |
| Catalog Number | HY-153058 |
| Research Area | Neurological Disease; Cancer |
| CAS# | 2770269-44-6 |
| Purity | ≥98.00% |
| SMILES | FC1=CC=CC(F)=C1C2=NC3=C(C4=C(N2CCC5)N5N=C4)NN=C3 |
| PubChem Chemical Structure ID | 163302597 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lrrk2-in-8.html |