LSN3160440 | MedChemExpress (MCE)
LSN3160440 is an allosteric modulator of GLP-1R, which acts as a protein–protein interaction (PPI) stabilizer or molecular glue to assist in the adhesion of inactive GLP-1 (9-36) NH2 on GLP-1R[1][2].
| Trivial name | LSN3160440 |
| Catalog Number | HY-153193 |
| Research Area | Metabolic Disease |
| CAS# | 2765539-59-9 |
| Purity | ≥98.00% |
| SMILES | C[C@H](C1=C(C(OC)=CC=C1Cl)Cl)N2C3=CC(C4=C([C@H]5CCCCN5)C=CC=C4)=CC=C3N=C2 |
| PubChem Chemical Structure ID | 146155955 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lsn3160440.html |