VH 032 amide-PEG6-amine hydrochloride | MedChemExpress (MCE)
VH 032 amide-PEG6-amine hydrochloride (Step 4) is a functionalized von-Hippel-Lindau protein-ligand (VHL) for PROTAC development, consisting of an E3 ligand and a PEG6 ligand. Terminal amines can be coupled to target protein ligands[1].
| Trivial name | VH 032 amide-PEG6-amine hydrochloride |
| Catalog Number | HY-163209 |
| Alternative Name(s) | (S,R,S)-AHPC-PEG6-NH2 hydrochloride |
| Research Area | Cancer |
| CAS# | 2763910-08-1 |
| Purity | ≥98.0% |
| SMILES | NCCOCCOCCOCCOCCOCCOCC(N[C@@H](C(C)(C)C)C(N1[C@@H](C[C@H](C1)O)C(NCC2=CC=C(C3=C(N=CS3)C)C=C2)=O)=O)=O.Cl.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/vh-032-amide-peg6-amine-hydrochloride.html |