Mal-Gly-PAB-Exatecan-D-glucuronic acid | MedChemExpress (MCE)
Mal-Gly-PAB-Exatecan-D-glucuronic acid can be used for Antibody-Drug Conjugates (ADCs) synthesis. Mal-Gly-PAB-Exatecan-D-glucuronic acid can be used for research of tumor research and diagnosis[1].
| Trivial name | Mal-Gly-PAB-Exatecan-D-glucuronic acid |
| Catalog Number | HY-153179 |
| Research Area | Cancer |
| CAS# | 2763252-25-9 |
| Purity | 99.20% |
| SMILES | O=C(C=CC1=O)N1CCC(NCC(NC(C=C2COC(N[C@@H]3C4=C5C(C(N6C5)=CC([C@](O)(C(OC7)=O)CC)=C7C6=O)=NC8=CC(F)=C(C)C(CC3)=C84)=O)=C(C=C2)O[C@@H]9O[C@@H]([C@H]([C@@H]([C@H]9O)O)O)C(O)=O)=O)=O |
| PubChem Chemical Structure ID | 168265660 |
| Size | 100 mg |
| Supplier Page | https://www.medchemexpress.com/mal-gly-pab-exatecan-d-glucuronic-acid.html |