mG2N001 | MedChemExpress (MCE)
mG2N001 is a negative allosteric modulator (NAM) (IC50: 93 nM) of the metabotropic glutamate receptor mGluR2 and binds to mGluR2 as an antagonist (Ki: 63 nM). mG2N001 is microparticle- and plasma-stable, and its radioisotope [11C]mG2N001 can be used in PET imaging. [11C]mG2N001 has good brain heterogeneity and brain penetration, and can selectively accumulate in mGluR2-rich regions, producing high-contrast brain images[1].
| Trivial name | mG2N001 |
| Catalog Number | HY-157998 |
| Research Area | Others |
| CAS# | 2760515-88-4 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=NC2=C(C(C3=C(F)C=C(OC)C=C3)=C1)CCC(C)(C)O2)N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mg2n001.html |