Lp-PLA2-IN-14 | MedChemExpress (MCE)
Lp-PLA2-IN-14 (Compound 19) is an Lp-PLA2 inhibitor with a pIC50 of 8.4 against rhLp-PLA2. Lp-PLA2-IN-14 can be used for the research of neurodegenerative related diseases, such as Alzheimer Disease (AD), glaucoma, age-related macular degeneration (AMD) or cardiovascular diseases including atherosclerosis and the like[1].
| Trivial name | Lp-PLA2-IN-14 |
| Catalog Number | HY-153560 |
| Research Area | Neurological Disease |
| CAS# | 2756855-66-8 |
| Purity | ≥98.00% |
| SMILES | O=C1N=C(C2=C(N1CCC3)N3CCO2)OCC4=CC(F)=C(C(F)=C4)F |
| PubChem Chemical Structure ID | 166928912 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lp-pla2-in-14.html |