MD102 | MedChemExpress (MCE)
MD102 is a potent TG2 inhibitor with an IC50 value of 0.35 μM. MD102 stabilizes p53 by inhibiting TG2, inducing a decrease in p-AKT and p-mTOR downstream signaling, leading to tumor cell apoptosis[1].
| Trivial name | MD102 |
| Catalog Number | HY-162141 |
| Research Area | Cancer |
| CAS# | 2755794-94-4 |
| Purity | ≥98.00% |
| SMILES | BrC1=CC=C(C2=NC(C(C(Cl)=C(Cl)C3=O)=O)=C3N2)C=C1F |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/md102.html |