Gambogic Acid
Gambogic acid activates caspases with EC50 of 0.78-1.64 μM and competitively inhibits Bcl-XL, Bcl-2, Bcl-W, Bcl-B, Bfl-1 and Mcl-1 with IC50 of 1.47, 1.21, 2.02, 0.66, 1.06 and 0.79 μM, respectively.
| Trivial name | Guttatic Acid; Guttic Acid; beta-Guttiferrin; β-Guttiferrin |
| Catalog Number | CSN13795 |
| Alternative Name(s) | Guttatic Acid; Guttic Acid; beta-Guttiferrin; β-Guttiferrin |
| Research Area | Cancer |
| Molecular Formula | C38H44O8 |
| CAS# | 2752-65-0 |
| Purity | ≥99% |
| SMILES | O=C(O)/C(C)=C\C[C@@]1(C2=O)OC(C)(C)[C@@](C[C@@]2([H])C=C34)([H])[C@]31OC5=C(C(O)=C(C=C[C@](CC/C=C(C)/C)(C)O6)C6=C5C/C=C(C)\C)C4=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/gambogic-acid.html |