Ensulizole
Ensulizole (PBSA), a water soluble sunscreen ingredient, is a sulfonated UV absorber which is characterized by intense UVB and partial UVA absorption. Ensulizole can damage the DNA through the generation of reactive oxygen species (ROS) upon UV or sunlight irradiation.
Trivial name | PBSA |
Catalog Number | S4419 |
Molecular Formula | C13H10N2O3S |
CAS# | 27503-81-7 |
Inchi | #N/A |
Inchi Key | #N/A |
SMILES | O[S](=O)(=O)C1=CC2=C(C=C1)N=C([NH]2)C3=CC=CC=C3 |
Size | 100mg |
Supplier Page | http://www.selleckchem.com/products/ensulizole.html |
Additional Information | https://file.selleck.cn/downloads/struct/s4419-ensulizole-chemical-structure.gif |