Ensulizole (Standard) | MedChemExpress (MCE)
Ensulizole (Standard) is the analytical standard of Ensulizole. This product is intended for research and analytical applications. Ensulizole is a sulfonated UV absorber and can intense UVB and partial UVA absorption. Ensulizole can damage the DNA through the generation of reactive oxygen species (ROS) upon UV or sunlight irradiation[1].
| Trivial name | Ensulizole (Standard) |
| Catalog Number | HY-109654R |
| Research Area | Metabolic Disease |
| CAS# | 27503-81-7 |
| Purity | ≥98.0% |
| SMILES | O=S(C1=CC=C2N=C(C3=CC=CC=C3)NC2=C1)(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ensulizole-standard.html |