Vildagliptin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10170 |
| Alternative Name(s) | (2S)-1-[2-[(3-Hydroxytricyclo[3.3.1.13,7]dec-1-yl)amino]acetyl]-2-pyrrolidinecarbonitrile; LAF 237; NVP-LAF 237; Galvus; |
| Research Area | Glyptins are class of oral anti-hyperglycemic agents that inhibit dipeptidyl peptidase 4 (DPP-4), which can act as a serine exopeptidase. ASide from there use in type 2 diabetes, gliptins have positive cardiovascular and anti-inflammtatory effects. Antidi |
| Molecular Formula | C17H25N3O2 |
| CAS# | 274901-16-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CCC1)[C@@H]1C#N)CN[C@](C[C@H](C2)C3)(C[C@@H]2C4)C[C@]34O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10170.html |
| Additional Information | NULL |