(2,4-Dichloro-3,5-dimethoxyphenyl) methyl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside | MedChemExpress (MCE)
(2,4-Dichloro-3,5-dimethoxyphenyl) methyl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside is an anticancer agent that inhibits the proliferation of lung cancer A549 cells (IC50=29 μΜ). (2,4-Dichloro-3,5-dimethoxyphenyl) methyl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside can be obtained from Lilium regale and can be used in cancer research[1].
| Trivial name | (2,4-Dichloro-3,5-dimethoxyphenyl) methyl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Catalog Number | HY-N12079 |
| Research Area | Cancer |
| CAS# | 2739844-79-0 |
| Purity | ≥98.00% |
| SMILES | OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC[C@H]([C@H]([C@@H]([C@H]2O)O)O)O[C@H]2OCC3=C(C(OC)=C(C(OC)=C3)Cl)Cl |
| PubChem Chemical Structure ID | 165430716 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-4-dichloro-3-5-dimethoxyphenyl-methyl-6-o-β-d-glucopyranosyl-β-d-glucopyranoside.html |