BODIQPy-TPA | MedChemExpress (MCE)
BODIQPy-TPA is a lipophilic probes, which induces ferroptosis in B16 and HepG2 cells upon light irradiation through lipid peroxidation. BODIQPy-TPA reveals a maximum absorption wavelength of 488 nm and a maximum emission wavelength above 640 nm[1].
| Trivial name | BODIQPy-TPA |
| Catalog Number | HY-163286 |
| Research Area | Others |
| CAS# | 2738333-02-1 |
| Purity | ≥98.0% |
| SMILES | [F-][B+3]1([N-]2C(C3=CC(/C=C/C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC=C6)=CC=[N]31)=NC7=CC=CC=C7C2=O)[F-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bodiqpy-tpa.html |