Furosemide EP impurity B
2,4-Dichloro-5-sulfamoylbenzoic Acid is a chlorinated sulfamoylbenzoic acid with diuretic acid.;Impurity in commercial preparations of Furosemide
| Catalog Number | CS-O-07843 |
| Alternative Name(s) | 2,4-Sulfamoyl-4,6 acid; 5-Aminosulfonyl-2,4-dichlorobenzoic acid; 5-Carboxy-2,4-dichlorobenzenesulfonamide; 5-(Aminosulfonyl)-2,4-dichlorobenzoic Acid; Furosemide Impurity B; CS-O-32023; 2,4-Dichloro-5-sulfamoylbenzoic acid; 3-Sulfamoyl-4,6-dichlorobenzoic acid; CS-O-30636; Lasamide |
| Molecular Formula | C7H5Cl2NO4S |
| CAS# | 2736-23-4 |
| Purity | >98% |
| SMILES | N[S](=O)(C1=CC(C(O)=O)=C(Cl)C=C1Cl)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07843.html |