Methyl Eicosapentaenoate
Fatty Acid Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-01924 |
| Alternative Name(s) | Methyl all-cis-5,8,11,14,17-eicosapentaenoate;(5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17 (all-Z)-5,8,11,14,17cid Methyl Ester; all-cis- 5,8,11,14,17-Eicosapentaenoic Acid Methyl Ester; Methyl 5Z,8Z,11Z,14Z,17Z-eicosapentaenoate; Methyl all-cis-5,8,11,14,17-eicosapentaenoate; Methyl cis,cis,cis,cis,cis-Eicosa-5,8,11,14,17-pentenoate; Methyl cis-5,8,11,14,17-Eicosapentaenoate; cis-5,8,11,14,17-Eicosapentaenoic Acid Methyl Ester |
| Research Area | Methyl eicosapentaenoate is the methyl ester derivative of Eicosapentaenoic acid. Methyl eicosapentaenoate is a highly unsaturated compound that is extracted from algae, and has some practical application in protecting stored grains against rice weevils. |
| Molecular Formula | C21H32O2 |
| CAS# | 2734-47-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OC)CCC/C=CC/C=CC/C=CC/C=CC/C=CCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01924.html |
| Additional Information | NULL |