Tirapazamine
Tirapazamine is an experimental anticancer drug that is activated to a toxic radical only at very low levels of oxygen.
| Trivial name | SR 259075; SR-4233; Win 59075 |
| Catalog Number | CSN19358 |
| Alternative Name(s) | SR 259075; SR-4233; Win 59075 |
| Research Area | Cancer |
| Molecular Formula | C7H6N4O2 |
| CAS# | 27314-97-2 |
| Purity | ≥99% |
| SMILES | NC1=[N+]([O-])C2=CC=CC=C2[N+]([O-])=N1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tirapazamine.html |