Tirapazamine
Anticancer drug Others|Others
| Catalog Number | B3399-200 |
| Research Area | Others|Others |
| Molecular Formula | C7H6N4O2 |
| CAS# | 27314-97-2 |
| Purity | 98.51% |
| SMILES | C1=CC=C2C(=C1)N(C(=N)N=[N+]2[O-])O |
| Size | 200mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3399 |
