LONP1-IN-2 | MedChemExpress (MCE)
LONP1-IN-2 (compound 9d) is a potent and selective LONP1 inhibitor with IC50 values of 0.187 μM and >10 μM for LONP1 and 20S proteasome, respectively. LONP1-IN-2 can be used in research of cancer[1].
| Trivial name | LONP1-IN-2 |
| Catalog Number | HY-153034 |
| Research Area | Cancer |
| CAS# | 2729981-17-1 |
| Purity | 99.74% |
| SMILES | CC(C)C[C@@H](B(O)O)NC([C@@H](CCCC)NC(C1=NC=CN=C1)=O)=O |
| PubChem Chemical Structure ID | 164611915 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/lonp1-in-2.html |