LD-ATTEC4 | MedChemExpress (MCE)
LD-ATTEC4 (compound 4A) is a coupling compound that can bind to LC3, with a Kd of 0.39 μM for LC3B. LD-ATTEC4 can connect autophagosomes with lipid droplets, inducing autophagy to clear lipid droplets[1].
| Trivial name | LD-ATTEC4 |
| Catalog Number | HY-157209 |
| Research Area | Metabolic Disease |
| CAS# | 2722678-54-6 |
| Purity | ≥98.00% |
| SMILES | O=C1OC2=CC(O)=CC(OCCCCCCCCCCOC3=C(/N=N/C4=CC=C(C=C4)/N=N/C5=CC=CC=C5)C6=C(C=CC=C6)C=C3)=C2C(C7=CC=CC=C7)=C1 |
| PubChem Chemical Structure ID | 163700912 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ld-attec4.html |