BRD K4477 10mM * 1mL in DMSO
Enhances differentiation of induced pluripotent stem cells (iPSCs) to hepatocytes; also promotes the maturation of iPSC-derived hepatocytes.
| Trivial name | BRD K4477 10mM * 1mL in DMSO |
| Catalog Number | A14153-10mM-D |
| Alternative Name(s) | N,N'-(Methylenedi-4,1-phenylene)bis-acetamide |
| Molecular Formula | C17H18N2O2 |
| CAS# | 2719-05-3 |
| SMILES | CC(=O)NC1=CC=C(C=C1)CC2=CC=C(C=C2)NC(=O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/brd-k4477.html |