Cefazolin Sodium
Cefazolin Sodium (cefazoline, cephazolin, Ancef) is a semisynthetic cephalosporin analog with broad-spectrum antibiotic action due to inhibition of bacterial cell wall synthesis. It attains high serum levels and is excreted quickly via the urine.
| Trivial name | cefazoline sodium, cephazolin sodium, Ancef |
| Catalog Number | S4595 |
| Molecular Formula | C27H19ClN2O3 |
| CAS# | 27164-46-1 |
| Inchi | InChI=1S/C27H19ClN2O3/c1-16-7-12-20(13-21(16)26(31)32)33-27-29-24-14-22(23(28)15-25(24)30-27)19-10-8-18(9-11-19)17-5-3-2-4-6-17/h2-15H,1H3,(H,29,30)(H,31,32) |
| Inchi Key | FIKQZQDYGXAUHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=NC3=C(N2)C=C(C(=C3)C4=CC=C(C=C4)C5=CC=CC=C5)Cl)C(=O)O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/cefazolin-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/cefazolin-sodium-chemical-structure-s4595.gif |
