Cefazolin Sodium
A semisynthetic cephalosporin analog with broad-spectrum antibiotic action due to inhibition of bacterial cell wall synthesis. It attains high serum levels and is excreted quickly via the urine.
| Catalog Number | API27164461 |
| Alternative Name(s) | Cefazolin sodium salt Cefazoline sodium Ancef |
| Research Area | Antibacterial APIs |
| Molecular Formula | C14H13N8NaO4S3 |
| CAS# | 27164-46-1 |
| SMILES | CC1=NN=C(S1)SCC2=C(N3C(C(C3=O)NC(=O)CN4C=NN=N4)SC2)C(=O)[O-].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/cefazolin-sodium-item-11575.html |