LRRK2-IN-10 | MedChemExpress (MCE)
LRRK2-IN-10 (compound 34) is a potent, mutation-selective, and brain penetrant G2019S-LRRK2 kinase inhibitor with IC50s of 11 nM and 5.2 nM for G2019S-LRRK2 pS935 and G2019S-LRRK2 pS1292, respectively. LRRK2-IN-10 has the potential for Parkinson’s disease research[1].
| Trivial name | LRRK2-IN-10 |
| Catalog Number | HY-156167 |
| Research Area | Neurological Disease |
| CAS# | 2704562-80-9 |
| Purity | ≥98.00% |
| SMILES | N#CC1=CC(CC2)=C(C=C1)[C@H]2NC3=CC4=C(C=C3)NN=C4C5=CON=C5 |
| PubChem Chemical Structure ID | 156850815 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lrrk2-in-10.html |