KCC2 Modulator-1 | MedChemExpress (MCE)
KCC2 Modulator-1 (Example 52) is a KCC2 modulator with an EC50 value of 0.146 μM. KCC2 Modulator-1 can be used for the research of KCC2 mediated diseases[1].
| Trivial name | KCC2 Modulator-1 |
| Catalog Number | HY-160081 |
| Research Area | Neurological Disease; Cancer |
| CAS# | 2704531-36-0 |
| Purity | ≥98.00% |
| SMILES | O=C1C2=C(CN1C(C)C)C(NC3=CC=C(C4=CC=C(OCCCCCC#C)C=C4)C=C3)=NC(N5CCOC(C6CC6)C5)=N2 |
| PubChem Chemical Structure ID | 156852533 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kcc2-modulator-1.html |