5(10)-Estrene-3β, 17a-Diol
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-11098 |
| Alternative Name(s) | (3S,8R,9S,13S,14S,17R)-13-methyl-2,3,4,6,7,8,9,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| Research Area | 5(10)-Estrene-3ß,17a-diol acts as a biological marker of pregnancy in female horses, also used to identify anabolic steroid use in make horses. |
| Molecular Formula | C18H28O2 |
| CAS# | 268734-48-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@H]2O)[C@](CC2)([H])[C@@](CCC3=C4CC[C@H](O)C3)([H])[C@]4([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11098.html |
| Additional Information | NULL |