Indapamide (Lozol) 10mM * 1mL in DMSO
Indapamide(Lozol) is a non-thiazide sulphonamide diuretic compound, generally used in the treatment of hypertension, as well as decompensated cardiac failure.
| Trivial name | Indapamide (Lozol) 10mM * 1mL in DMSO |
| Catalog Number | A10470-10mM-D |
| Alternative Name(s) | 1-(4-Chloro-3-sulfamoylbenzamido)-2-methylindoline; N-(4-Chloro-3-sulfamoylbenzamido)-2-methylindoline |
| Molecular Formula | C16H16ClN3O3S |
| CAS# | 26807-65-8 |
| SMILES | CC1CC2=CC=CC=C2N1NC(=O)C3=CC(=C(C=C3)Cl)S(=O)(=O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/indapamide-lozol.html |