LUNA18 | MedChemExpress (MCE)
LUNA18 is an orally active KRAS inhibitor with an IC50 of ＜2 nM against KRASG12D-SOS. LUNA18 can be used for the research of cancer[1].
| Trivial name | LUNA18 |
| Catalog Number | HY-156002 |
| Research Area | Cancer |
| CAS# | 2676177-63-0 |
| Purity | 99.26% |
| SMILES | CC1=CC=C(C[C@@H](C(N(CC(N[C@H](C(N2CCC[C@H]2C(NC3(CCCC3)C(N(C)[C@H](C(N4C)=O)C5CCCC5)=O)=O)=O)CCC6=CC(F)=C(C(F)=C6)C(F)(F)F)=O)C)=O)N(C([C@@H]7CCN7C([C@H](C)N(C)C([C@H]([C@@H](C)CC)NC([C@H](CC(C)C)N(C)C(C[C@H]4C(N(C)C)=O)=O)=O)=O)=O)=O)CC)C=C1 |
| PubChem Chemical Structure ID | 166509683 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/luna18.html |