Reparixin L-lysine salt 50mg
Reparixin L-lysine salt is an inhibitor of CXCL8 receptor, also inhibit CXCR1 and CXCR2 activation,which has been shown to attenuate inflammatory responses in various injury models.
| Trivial name | Reparixin L-lysine salt 50mg |
| Catalog Number | A15219-50 |
| Alternative Name(s) | (2S)-2,6-diaminohexanoic acid;(2R)-2-[4-(2-methylpropyl)phenyl]-N-methylsulfonylpropanamide |
| Molecular Formula | C20H35N3O5S |
| CAS# | 266359-93-7 |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)NS(=O)(=O)C.C(CCN)CC(C(=O)O)N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/reparixin-l-lysine-salt.html |
