Reparixin
Reparixin is an inhibitor of CXCL8 receptor, also inhibit CXCR1 and CXCR2 activation, which has been shown to attenuate inflammatory responses in various injury models.
| Trivial name | Repertaxin; DF1681-Y |
| Catalog Number | CSN15950 |
| Alternative Name(s) | Repertaxin; DF1681-Y |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C14H21NO3S |
| CAS# | 266359-83-5 |
| Purity | ≥99% |
| SMILES | O=C(NS(=O)(C)=O)[C@H](C)C1=CC=C(CC(C)C)C=C1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/reparixin.html |