KRAS G12C inhibitor 62 | MedChemExpress (MCE)
KRAS G12C inhibitor 62 is a KRAS G12C inhibitor. KRAS G12C inhibitor 62 has the potential for the research of KRAS G12C-mediated cancer (extracted from patent WO2021121367A1)[1].
| Trivial name | KRAS G12C inhibitor 62 |
| Catalog Number | HY-157067 |
| Research Area | Cancer |
| CAS# | 2658588-10-2 |
| Purity | ≥98.00% |
| SMILES | N#CC1=C(N2CCN(CC2)C(C=C)=O)C3=C(N=C(C4=C(N)C(F)=C(F)C(F)=C4F)C(Cl)=C3)N(C5=C(C)C=CN=C5C(C)C)C1=O |
| PubChem Chemical Structure ID | 157827766 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kras-g12c-inhibitor-62.html |