4′-Hydroxychalcone
4′-Hydroxychalcone has diverse biological activities including inhibiting TNFα-induced NF-κB pathway activation and activating BMP signaling. It is found in herbs and spices and tea, is a member of the class of compounds known as retrochalcones.
| Trivial name | / |
| Catalog Number | CSN23578 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C15H12O2 |
| CAS# | 2657-25-2 |
| Purity | ≥99% |
| SMILES | OC1=CC=C(C=C1)C(=O)C=CC1=CC=CC=C1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/4'-hydroxychalcone.html |
