KT-413
KT-413 (IRAK degrader-1, zomiradomide) is a dual-function PROTAC molecule and a potent degrader of interleukin-1 receptor associated kinase 4 (IRAK4) and the transcription factors Ikaros and Aiolos by acting as both a heterobifunctional degrader and a molecular glue. It can be used in research for developing therapies targeting the activated B-cell (ABC) subtype of diffuse large B-cell lymphoma (DLBCL).
| Trivial name | IRAK degrader-1, zomiradomide |
| Catalog Number | E4669 |
| Molecular Formula | C43H49NO18 |
| CAS# | 2655656-99-6 |
| SMILES | CC1CCC2=C(C=CC=N2)C(=O)OCC3(C4C(C(C5(C(C(C(C(C5(C4OC(=O)C)O3)(C)O)OC1=O)OC(=O)C6=CC=CC=C6)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/kt-413.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4669-KT-413-chemical-structure.png |
