Fosaprepitant Dimeglumine
Fosaprepitant Dimeglumine is a prodrug for aprepitant which is a selective and high-affinity antagonist of NK1 receptor.
| Trivial name | Fosaprepitant Dimeglumine Salt; MK0517 |
| Catalog Number | CSN12336 |
| Alternative Name(s) | Fosaprepitant Dimeglumine Salt; MK0517 |
| Research Area | Neurological Disease |
| Molecular Formula | C37H56F7N6O16P |
| CAS# | 265121-04-8 |
| Purity | ≥98% |
| SMILES | OCC(O)C(O)C(O)C(O)CNC.OCC(O)C(O)C(O)C(O)CNC.O=C1NC(CN2[C@@H](C3=CC=C(F)C=C3)[C@@H](O[C@@H](C4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)C)OCC2)=NN1P(O)(O)=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/fosaprepitant-dimeglumine.html |