(Rac)-Upacicalcet
(Rac)-Upacicalcet is a racemate of Upacicalcet, which serves as an intravenous calcimimetic agent. Upacicalcet acts by directly targeting calcium-sensing receptors on parathyroid cell membranes, effectively suppressing the release of excessive parathyroid hormone (PTH) and reducing blood PTH levels. This compound holds the potential for researching secondary hyperparathyroidism (SHPT) [1].
| Catalog Number | T61232 |
| Molecular Formula | C11H14ClN3O6S |
| CAS# | 2649575-19-7 |
| SMILES | Cc1c(Cl)cc(cc1NC(=O)NCC(N)C(O)=O)S(O)(=O)=O |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/(rac)-upacicalcet |
| Additional Information | https://www.targetmol.com/datasheet/T61232 |
