VV116
VV116, a promising orally administered anti-SARS-CoV-2 nucleoside drug candidate, exerts functions by targeting the viral RNA-dependent RNA polymerase through its nucleoside triphosphate form with an IC50 of 0.67±0.24 μM.
| Trivial name | JT001 |
| Catalog Number | E1111 |
| Molecular Formula | C24H30DN5O7 |
| CAS# | 2647442-33-7(free base) |
| SMILES | CC(C)C(=O)OCC1OC(C#N)(C(OC(=O)C(C)C)C1OC(=O)C(C)C)C2=CC(=C3[N]2N=CN=C3N)[2H] |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/vv116.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e1111-vv116-chemical-structure.gif |