SB 415286 10mg
SB 415286 is a potent and selective cell-permeable, ATP-competitive inhibitor of GSK3?? with an IC50 value of 78 nM (similar potency for GSK3??) and a Ki value of 31 nM.
| Trivial name | SB 415286 10mg |
| Catalog Number | A11061-10 |
| Alternative Name(s) | 3-[(3-Chloro-4-hydroxyphenyl)amino]-4-(2-nitrophenyl)-1H-pyrrole-2,5-dione |
| Molecular Formula | C16H10ClN3O5 |
| CAS# | 264218-23-7 |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=O)NC2=O)NC3=CC(=C(C=C3)O)Cl)[N+](=O)[O-] |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/sb-415286.html |
