Lp-PLA2-IN-12 | MedChemExpress (MCE)
Lp-PLA2-IN-12 (compound 19) is an Lp-PLA2 inhibitor. Lp-PLA2-IN-12 can be used for the study of neurodegenerative related diseases such as Alzheimer’s disease (AD), glaucoma, age-related macular degeneration (AMD), or cardiovascular disease including atherosclerosis[1].
| Trivial name | Lp-PLA2-IN-12 |
| Catalog Number | HY-153183 |
| Research Area | Neurological Disease; Cardiovascular Disease |
| CAS# | 2637485-14-2 |
| Purity | ≥98.00% |
| SMILES | O=C1N2C[C@]3(CC[C@H]4CCC3)N4C2=CC(OCC(C=C5F)=CC(F)=C5OC(C=N6)=CN=C6C)=N1 |
| PubChem Chemical Structure ID | 156234033 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lp-pla2-in-12.html |