L-Arginine Methyl Ester Dihydrochloride
Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-10890 |
| Alternative Name(s) | H-Arg-OMe.2HCl; |
| Research Area | L-Arginine methyl ester is a protected form of L-Arginine . L-Arginine is an conditionally essential amino acid for humans and adult mammals as it's requirements exceed production during certain developmental stages in life (such as pregnancy). L-Arginine also prevents blood toxicity from intravenous amino acid administration in humans. |
| Molecular Formula | C7H18Cl2N4O2 |
| CAS# | 26340-89-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H](C(OC)=O)CCCNC(N)=N.Cl.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10890.html |
| Additional Information | NULL |