NDI-101150
NDI-101150 is a potent HPK1 (MAP4K1) inhibitor that selectively activates immune cells such as T cells, B cells, and dendritic cells. It significantly inhibits tumor growth and induces complete tumor regression in the EMT-6 mouse model.
| Catalog Number | E4726 |
| Molecular Formula | C18H19N3O2S |
| CAS# | 2628486-22-4 |
| SMILES | CC1=CC(=CC(=C1O)C)C2=NC3=C(C4=C(S3)CN(CC4)C)C(=O)N2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/ndi-101150.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4726-NDI-101150-chemical-structure.png |
