Lenalidomide 4′-PEG3-amine, dihydrochloride | MedChemExpress (MCE)
Lenalidomide 4′-PEG3-amine dihydrochloride is the Lenalidomide-based Cereblon ligand used in the recruitment of CRBN protein. Lenalidomide 4′-PEG3-amine dihydrochloride can be connected to the ligand for protein by a linker to form PROTAC[1].
| Trivial name | Lenalidomide 4'-PEG3-amine, dihydrochloride |
| Catalog Number | HY-161130 |
| Research Area | Cancer |
| CAS# | 2624336-87-2 |
| Purity | ≥98.00% |
| SMILES | O=C1NC(C(CC1)N2C(C3=C(C2)C(NCCOCCOCCOCCN)=CC=C3)=O)=O.Cl.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lenalidomide-4-peg3-amine-dihydrochloride.html |