Lenalidomide-acetylene-Br | MedChemExpress (MCE)
Lenalidomide-acetylene-Br is a PROTAC Linker taht makes up HJM-561 (HY-156698). HJM-561 is a potent, selective, and orally active EGFR PROTAC to inhiibit Osimertinib (HY-15772)-resistant EGFR triple mutations.
| Trivial name | Lenalidomide-acetylene-Br |
| Catalog Number | HY-156700 |
| Research Area | Cancer |
| CAS# | 2619512-84-2 |
| Purity | ≥98.00% |
| SMILES | O=C1NC(C(CC1)N2C(C3=C(C2)C(C#CCCBr)=CC=C3)=O)=O |
| PubChem Chemical Structure ID | 156135030 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lenalidomide-acetylene-br.html |