CPD-002 | MedChemExpress (MCE)
CPD-002 is an inhibitor for vascular endothelial growth factor receptor 2(VEGFR2), that inhibits angiogenesis through inhibition of VEGFR2/PI3K/AKT signaling pathway. CPD-002 exhibits anti-inflammatory activity and attenuates rheumatoid arthritis[1].
| Trivial name | CPD-002 |
| Catalog Number | HY-163533 |
| Research Area | Inflammation/Immunology |
| CAS# | 2617376-08-4 |
| Purity | ≥98.0% |
| SMILES | CNC(C1=CC=CC=C1SC2=CC3=C(C(NC(C)=O)=NN3)C=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cpd-002.html |