Naproxen sodium 250mg
Naproxen sodium is a non-selective cyclooxygenase (COX) inhibitor that displays anti-inflammatory, antipyretic and analgesic effects. Has a neuroprotective role against colchicine-induced cognitive impairment and oxidative stress.
Trivial name | Naproxen sodium 250mg |
Catalog Number | A10623-250 |
Alternative Name(s) | (2S)-2-(6-Methoxy-2-naphthyl)propan?oic acid sodium salt |
Molecular Formula | C₁₄H₁₃NaO₃ |
CAS# | 26159-34-2 |
SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)[O-].[Na+] |
Size | 250mg |
Supplier Page | http://www.adooq.com/naproxen-sodium.html |