MLK-IN-2 | MedChemExpress (MCE)
MLK-IN-2 (Compound 9a) is a Mixed Lineage Kinase 3 (MLK3) inhibitor containing 3H-imidazole [4,5-b] pyridine structure. IC50 value is 6 nM. MLK-IN-2 can be used to study cancer and neurodegenerative diseases[1].
| Trivial name | MLK-IN-2 |
| Catalog Number | HY-161271 |
| Research Area | Neurological Disease; Cancer |
| CAS# | 2614255-51-3 |
| Purity | ≥98.0% |
| SMILES | O=C(N1CCOCC1)C2=CC=CC(N3C(C)=C(C4=NC(C(N[C@H]5CCN(S(CC)(=O)=O)C5)=C(Br)C=N6)=C6N4)C=C3C)=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mlk-in-2.html |